About 4-oxopentyl 2-[4-(2-methylpropyl)phenyl]acetate
4-oxopentyl 2-[4-(2-methylpropyl)phenyl]acetate (PubChem CID 78846651) has the molecular formula C17H24O3
and a molecular weight of 276.38 g/mol. Its IUPAC name is 4-oxopentyl 2-[4-(2-methylpropyl)phenyl]acetate.
Molecular Properties
| Compound Name | 4-oxopentyl 2-[4-(2-methylpropyl)phenyl]acetate |
| PubChem CID | 78846651 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 4-oxopentyl 2-[4-(2-methylpropyl)phenyl]acetate |
| SMILES | CC(=O)CCCOC(=O)Cc1ccc(CC(C)C)cc1 |
| InChI | InChI=1S/C17H24O3/c1-13(2)11-15-6-8-16(9-7-15)12-17(19)20-10-4-5-14(3)18/h6-9,13H,4-5,10-12H2,1-3H3 |
| InChIKey | LYXISLUALQVZQW-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-oxopentyl 2-[4-(2-methylpropyl)phenyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxopentyl 2-[4-(2-methylpropyl)phenyl]acetate?
The IUPAC name of 4-oxopentyl 2-[4-(2-methylpropyl)phenyl]acetate (CID 78846651) is 4-oxopentyl 2-[4-(2-methylpropyl)phenyl]acetate.
What is the SMILES notation for 4-oxopentyl 2-[4-(2-methylpropyl)phenyl]acetate?
The canonical SMILES for 4-oxopentyl 2-[4-(2-methylpropyl)phenyl]acetate is CC(=O)CCCOC(=O)Cc1ccc(CC(C)C)cc1.
What is the InChIKey of 4-oxopentyl 2-[4-(2-methylpropyl)phenyl]acetate?
The InChIKey is LYXISLUALQVZQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24O3/c1-13(2)11-15-6-8-16(9-7-15)12-17(19)20-10-4-5-14(3)18/h6-9,13H,4-5,10-12H2,1-3H3.
What are the key properties of 4-oxopentyl 2-[4-(2-methylpropyl)phenyl]acetate?
4-oxopentyl 2-[4-(2-methylpropyl)phenyl]acetate has a molecular weight of 276.38 g/mol, XLogP of 3.34, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxopentyl 2-[4-(2-methylpropyl)phenyl]acetate is sourced from PubChem (CID 78846651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).