C17H24ClNO2S — CID 78851465
2-[(5-chloro-2-methoxyphenyl)methylsulfanyl]-1-(4-methylpiperidin-1-yl)propan-1-one (PubChem CID 78851465) has the molecular formula C17H24ClNO2S and a molecular weight of 341.90 g/mol. Its IUPAC name is 2-[(5-chloro-2-methoxyphenyl)methylsulfanyl]-1-(4-methylpiperidin-1-yl)propan-1-one.
| Compound Name | 2-[(5-chloro-2-methoxyphenyl)methylsulfanyl]-1-(4-methylpiperidin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 78851465 |
| Molecular Formula | C17H24ClNO2S |
| Molecular Weight | 341.90 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 2-[(5-chloro-2-methoxyphenyl)methylsulfanyl]-1-(4-methylpiperidin-1-yl)propan-1-one |
| SMILES | COc1ccc(Cl)cc1CSC(C)C(=O)N1CCC(C)CC1 |
| InChI | InChI=1S/C17H24ClNO2S/c1-12-6-8-19(9-7-12)17(20)13(2)22-11-14-10-15(18)4-5-16(14)21-3/h4-5,10,12-13H,6-9,11H2,1-3H3 |
| InChIKey | XEIAKZXFZCZWIN-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.90 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |