C16H13N5O3 — CID 78852340
6-oxo-1-phenyl-N'-(1H-pyrrole-2-carbonyl)pyridazine-3-carbohydrazide (PubChem CID 78852340) has the molecular formula C16H13N5O3 and a molecular weight of 323.31 g/mol. Its IUPAC name is 6-oxo-1-phenyl-N'-(1H-pyrrole-2-carbonyl)pyridazine-3-carbohydrazide.
| Compound Name | 6-oxo-1-phenyl-N'-(1H-pyrrole-2-carbonyl)pyridazine-3-carbohydrazide |
|---|---|
| PubChem CID | 78852340 |
| Molecular Formula | C16H13N5O3 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 6-oxo-1-phenyl-N'-(1H-pyrrole-2-carbonyl)pyridazine-3-carbohydrazide |
| SMILES | O=C(NNC(=O)c1ccc[nH]1)c1ccc(=O)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H13N5O3/c22-14-9-8-13(20-21(14)11-5-2-1-3-6-11)16(24)19-18-15(23)12-7-4-10-17-12/h1-10,17H,(H,18,23)(H,19,24) |
| InChIKey | LFUBOCLZZWYOAR-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 108.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|