C19H19Cl2NO3S — CID 78852755
2-chloro-N-[1-(2-chlorophenyl)ethyl]-N-cyclopropyl-5-methylsulfonylbenzamide (PubChem CID 78852755) has the molecular formula C19H19Cl2NO3S and a molecular weight of 412.34 g/mol. Its IUPAC name is 2-chloro-N-[1-(2-chlorophenyl)ethyl]-N-cyclopropyl-5-methylsulfonylbenzamide.
| Compound Name | 2-chloro-N-[1-(2-chlorophenyl)ethyl]-N-cyclopropyl-5-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 78852755 |
| Molecular Formula | C19H19Cl2NO3S |
| Molecular Weight | 412.34 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | 2-chloro-N-[1-(2-chlorophenyl)ethyl]-N-cyclopropyl-5-methylsulfonylbenzamide |
| SMILES | CC(c1ccccc1Cl)N(C(=O)c1cc(S(C)(=O)=O)ccc1Cl)C1CC1 |
| InChI | InChI=1S/C19H19Cl2NO3S/c1-12(15-5-3-4-6-17(15)20)22(13-7-8-13)19(23)16-11-14(26(2,24)25)9-10-18(16)21/h3-6,9-13H,7-8H2,1-2H3 |
| InChIKey | RBWXQRDUKUSPDA-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.34 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |