C15H16Cl3NO — CID 78852811
2,2-dichloro-N-[1-(4-chlorophenyl)ethyl]-N-cyclopropylcyclopropane-1-carboxamide (PubChem CID 78852811) has the molecular formula C15H16Cl3NO and a molecular weight of 332.66 g/mol. Its IUPAC name is 2,2-dichloro-N-[1-(4-chlorophenyl)ethyl]-N-cyclopropylcyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-N-[1-(4-chlorophenyl)ethyl]-N-cyclopropylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 78852811 |
| Molecular Formula | C15H16Cl3NO |
| Molecular Weight | 332.66 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | 2,2-dichloro-N-[1-(4-chlorophenyl)ethyl]-N-cyclopropylcyclopropane-1-carboxamide |
| SMILES | CC(c1ccc(Cl)cc1)N(C(=O)C1CC1(Cl)Cl)C1CC1 |
| InChI | InChI=1S/C15H16Cl3NO/c1-9(10-2-4-11(16)5-3-10)19(12-6-7-12)14(20)13-8-15(13,17)18/h2-5,9,12-13H,6-8H2,1H3 |
| InChIKey | NHDDOZNXVYBMQD-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.66 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|