C14H17Cl2NO2 — CID 78846846
2,2-dichloro-N-[1-(4-methoxyphenyl)ethyl]-N-methylcyclopropane-1-carboxamide (PubChem CID 78846846) has the molecular formula C14H17Cl2NO2 and a molecular weight of 302.20 g/mol. Its IUPAC name is 2,2-dichloro-N-[1-(4-methoxyphenyl)ethyl]-N-methylcyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-N-[1-(4-methoxyphenyl)ethyl]-N-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 78846846 |
| Molecular Formula | C14H17Cl2NO2 |
| Molecular Weight | 302.20 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 2,2-dichloro-N-[1-(4-methoxyphenyl)ethyl]-N-methylcyclopropane-1-carboxamide |
| SMILES | COc1ccc(C(C)N(C)C(=O)C2CC2(Cl)Cl)cc1 |
| InChI | InChI=1S/C14H17Cl2NO2/c1-9(10-4-6-11(19-3)7-5-10)17(2)13(18)12-8-14(12,15)16/h4-7,9,12H,8H2,1-3H3 |
| InChIKey | AURGMFZXBAJOFW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.20 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|