About (4-methoxyphenyl) N-[1-(4-hydroxyphenyl)ethyl]-N-propan-2-ylcarbamate
(4-methoxyphenyl) N-[1-(4-hydroxyphenyl)ethyl]-N-propan-2-ylcarbamate (PubChem CID 20723585) has the molecular formula C19H23NO4
and a molecular weight of 329.40 g/mol. Its IUPAC name is (4-methoxyphenyl) N-[1-(4-hydroxyphenyl)ethyl]-N-propan-2-ylcarbamate.
Molecular Properties
| Compound Name | (4-methoxyphenyl) N-[1-(4-hydroxyphenyl)ethyl]-N-propan-2-ylcarbamate |
| PubChem CID | 20723585 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | (4-methoxyphenyl) N-[1-(4-hydroxyphenyl)ethyl]-N-propan-2-ylcarbamate |
| SMILES | COc1ccc(OC(=O)N(C(C)C)C(C)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C19H23NO4/c1-13(2)20(14(3)15-5-7-16(21)8-6-15)19(22)24-18-11-9-17(23-4)10-12-18/h5-14,21H,1-4H3 |
| InChIKey | SZRALWRMWSNMKN-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-methoxyphenyl) N-[1-(4-hydroxyphenyl)ethyl]-N-propan-2-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxyphenyl) N-[1-(4-hydroxyphenyl)ethyl]-N-propan-2-ylcarbamate?
The IUPAC name of (4-methoxyphenyl) N-[1-(4-hydroxyphenyl)ethyl]-N-propan-2-ylcarbamate (CID 20723585) is (4-methoxyphenyl) N-[1-(4-hydroxyphenyl)ethyl]-N-propan-2-ylcarbamate.
What is the SMILES notation for (4-methoxyphenyl) N-[1-(4-hydroxyphenyl)ethyl]-N-propan-2-ylcarbamate?
The canonical SMILES for (4-methoxyphenyl) N-[1-(4-hydroxyphenyl)ethyl]-N-propan-2-ylcarbamate is COc1ccc(OC(=O)N(C(C)C)C(C)c2ccc(O)cc2)cc1.
What is the InChIKey of (4-methoxyphenyl) N-[1-(4-hydroxyphenyl)ethyl]-N-propan-2-ylcarbamate?
The InChIKey is SZRALWRMWSNMKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23NO4/c1-13(2)20(14(3)15-5-7-16(21)8-6-15)19(22)24-18-11-9-17(23-4)10-12-18/h5-14,21H,1-4H3.
What are the key properties of (4-methoxyphenyl) N-[1-(4-hydroxyphenyl)ethyl]-N-propan-2-ylcarbamate?
(4-methoxyphenyl) N-[1-(4-hydroxyphenyl)ethyl]-N-propan-2-ylcarbamate has a molecular weight of 329.40 g/mol, XLogP of 4.37, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxyphenyl) N-[1-(4-hydroxyphenyl)ethyl]-N-propan-2-ylcarbamate is sourced from PubChem (CID 20723585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).