C17H26N2O4S — CID 78855409
N-ethyl-N-(2-hydroxyethyl)-3-(4-pyrrolidin-1-ylsulfonylphenyl)propanamide (PubChem CID 78855409) has the molecular formula C17H26N2O4S and a molecular weight of 354.47 g/mol. Its IUPAC name is N-ethyl-N-(2-hydroxyethyl)-3-(4-pyrrolidin-1-ylsulfonylphenyl)propanamide.
| Compound Name | N-ethyl-N-(2-hydroxyethyl)-3-(4-pyrrolidin-1-ylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 78855409 |
| Molecular Formula | C17H26N2O4S |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | N-ethyl-N-(2-hydroxyethyl)-3-(4-pyrrolidin-1-ylsulfonylphenyl)propanamide |
| SMILES | CCN(CCO)C(=O)CCc1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C17H26N2O4S/c1-2-18(13-14-20)17(21)10-7-15-5-8-16(9-6-15)24(22,23)19-11-3-4-12-19/h5-6,8-9,20H,2-4,7,10-14H2,1H3 |
| InChIKey | HXDJPYANXIJYJW-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |