C14H15Cl2NO3 — CID 78858359
methyl 4-[[(2,2-dichlorocyclopropanecarbonyl)-methylamino]methyl]benzoate (PubChem CID 78858359) has the molecular formula C14H15Cl2NO3 and a molecular weight of 316.18 g/mol. Its IUPAC name is methyl 4-[[(2,2-dichlorocyclopropanecarbonyl)-methylamino]methyl]benzoate.
| Compound Name | methyl 4-[[(2,2-dichlorocyclopropanecarbonyl)-methylamino]methyl]benzoate |
|---|---|
| PubChem CID | 78858359 |
| Molecular Formula | C14H15Cl2NO3 |
| Molecular Weight | 316.18 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | methyl 4-[[(2,2-dichlorocyclopropanecarbonyl)-methylamino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN(C)C(=O)C2CC2(Cl)Cl)cc1 |
| InChI | InChI=1S/C14H15Cl2NO3/c1-17(12(18)11-7-14(11,15)16)8-9-3-5-10(6-4-9)13(19)20-2/h3-6,11H,7-8H2,1-2H3 |
| InChIKey | IPMVRLDDBFGGHR-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.18 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|