C24H26N4O2S — CID 78860343
N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-5-(phenylcarbamoylamino)thiophene-2-carboxamide (PubChem CID 78860343) has the molecular formula C24H26N4O2S and a molecular weight of 434.57 g/mol. Its IUPAC name is N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-5-(phenylcarbamoylamino)thiophene-2-carboxamide.
| Compound Name | N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-5-(phenylcarbamoylamino)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 78860343 |
| Molecular Formula | C24H26N4O2S |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-5-(phenylcarbamoylamino)thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccccc1)Nc1ccc(C(=O)NCCCN2CCc3ccccc3C2)s1 |
| InChI | InChI=1S/C24H26N4O2S/c29-23(25-14-6-15-28-16-13-18-7-4-5-8-19(18)17-28)21-11-12-22(31-21)27-24(30)26-20-9-2-1-3-10-20/h1-5,7-12H,6,13-17H2,(H,25,29)(H2,26,27,30) |
| InChIKey | PSLXXUUJBYYFRI-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|