C18H25BrN2O3S — CID 78871223
1-[3-(5-bromothiophen-2-yl)prop-2-enoyl]-N-(3-ethoxypropyl)piperidine-4-carboxamide (PubChem CID 78871223) has the molecular formula C18H25BrN2O3S and a molecular weight of 429.38 g/mol. Its IUPAC name is 1-[3-(5-bromothiophen-2-yl)prop-2-enoyl]-N-(3-ethoxypropyl)piperidine-4-carboxamide.
| Compound Name | 1-[3-(5-bromothiophen-2-yl)prop-2-enoyl]-N-(3-ethoxypropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 78871223 |
| Molecular Formula | C18H25BrN2O3S |
| Molecular Weight | 429.38 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | 1-[3-(5-bromothiophen-2-yl)prop-2-enoyl]-N-(3-ethoxypropyl)piperidine-4-carboxamide |
| SMILES | CCOCCCNC(=O)C1CCN(C(=O)C=Cc2ccc(Br)s2)CC1 |
| InChI | InChI=1S/C18H25BrN2O3S/c1-2-24-13-3-10-20-18(23)14-8-11-21(12-9-14)17(22)7-5-15-4-6-16(19)25-15/h4-7,14H,2-3,8-13H2,1H3,(H,20,23) |
| InChIKey | QDQBUVRBMZUSOW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|