C20H26Cl2N2O3 — CID 78871291
1-[(E)-3-(2,5-dichlorophenyl)prop-2-enoyl]-N-(3-ethoxypropyl)piperidine-4-carboxamide (PubChem CID 78871291) has the molecular formula C20H26Cl2N2O3 and a molecular weight of 413.35 g/mol. Its IUPAC name is 1-[(E)-3-(2,5-dichlorophenyl)prop-2-enoyl]-N-(3-ethoxypropyl)piperidine-4-carboxamide.
| Compound Name | 1-[(E)-3-(2,5-dichlorophenyl)prop-2-enoyl]-N-(3-ethoxypropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 78871291 |
| Molecular Formula | C20H26Cl2N2O3 |
| Molecular Weight | 413.35 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 1-[(E)-3-(2,5-dichlorophenyl)prop-2-enoyl]-N-(3-ethoxypropyl)piperidine-4-carboxamide |
| SMILES | CCOCCCNC(=O)C1CCN(C(=O)/C=C/c2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C20H26Cl2N2O3/c1-2-27-13-3-10-23-20(26)15-8-11-24(12-9-15)19(25)7-4-16-14-17(21)5-6-18(16)22/h4-7,14-15H,2-3,8-13H2,1H3,(H,23,26)/b7-4+ |
| InChIKey | NNMHLKBCVYDEST-QPJJXVBHSA-N |
| XLogP | 3.79 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.35 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|