C19H29N3O3S — CID 78875306
N-[4-(diethylamino)-4-oxobutyl]-1-(thiophene-2-carbonyl)piperidine-2-carboxamide (PubChem CID 78875306) has the molecular formula C19H29N3O3S and a molecular weight of 379.53 g/mol. Its IUPAC name is N-[4-(diethylamino)-4-oxobutyl]-1-(thiophene-2-carbonyl)piperidine-2-carboxamide.
| Compound Name | N-[4-(diethylamino)-4-oxobutyl]-1-(thiophene-2-carbonyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 78875306 |
| Molecular Formula | C19H29N3O3S |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | N-[4-(diethylamino)-4-oxobutyl]-1-(thiophene-2-carbonyl)piperidine-2-carboxamide |
| SMILES | CCN(CC)C(=O)CCCNC(=O)C1CCCCN1C(=O)c1cccs1 |
| InChI | InChI=1S/C19H29N3O3S/c1-3-21(4-2)17(23)11-7-12-20-18(24)15-9-5-6-13-22(15)19(25)16-10-8-14-26-16/h8,10,14-15H,3-7,9,11-13H2,1-2H3,(H,20,24) |
| InChIKey | JYMSCAAALYHAJH-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|