C18H15BrN2O4 — CID 78875469
2-(3-bromophenoxy)-N-[2-(furan-2-yl)-2-hydroxyethyl]pyridine-3-carboxamide (PubChem CID 78875469) has the molecular formula C18H15BrN2O4 and a molecular weight of 403.23 g/mol. Its IUPAC name is 2-(3-bromophenoxy)-N-[2-(furan-2-yl)-2-hydroxyethyl]pyridine-3-carboxamide.
| Compound Name | 2-(3-bromophenoxy)-N-[2-(furan-2-yl)-2-hydroxyethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 78875469 |
| Molecular Formula | C18H15BrN2O4 |
| Molecular Weight | 403.23 g/mol |
| Exact Mass | 402.02 |
| IUPAC Name | 2-(3-bromophenoxy)-N-[2-(furan-2-yl)-2-hydroxyethyl]pyridine-3-carboxamide |
| SMILES | O=C(NCC(O)c1ccco1)c1cccnc1Oc1cccc(Br)c1 |
| InChI | InChI=1S/C18H15BrN2O4/c19-12-4-1-5-13(10-12)25-18-14(6-2-8-20-18)17(23)21-11-15(22)16-7-3-9-24-16/h1-10,15,22H,11H2,(H,21,23) |
| InChIKey | MOWZXLITFYGAFO-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 84.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.23 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |