C22H20N6O3 — CID 78876010
N'-[4-(imidazol-1-ylmethyl)benzoyl]-3-(4-methoxyphenyl)-1H-pyrazole-5-carbohydrazide (PubChem CID 78876010) has the molecular formula C22H20N6O3 and a molecular weight of 416.44 g/mol. Its IUPAC name is N'-[4-(imidazol-1-ylmethyl)benzoyl]-3-(4-methoxyphenyl)-1H-pyrazole-5-carbohydrazide.
| Compound Name | N'-[4-(imidazol-1-ylmethyl)benzoyl]-3-(4-methoxyphenyl)-1H-pyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 78876010 |
| Molecular Formula | C22H20N6O3 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | N'-[4-(imidazol-1-ylmethyl)benzoyl]-3-(4-methoxyphenyl)-1H-pyrazole-5-carbohydrazide |
| SMILES | COc1ccc(-c2cc(C(=O)NNC(=O)c3ccc(Cn4ccnc4)cc3)[nH]n2)cc1 |
| InChI | InChI=1S/C22H20N6O3/c1-31-18-8-6-16(7-9-18)19-12-20(25-24-19)22(30)27-26-21(29)17-4-2-15(3-5-17)13-28-11-10-23-14-28/h2-12,14H,13H2,1H3,(H,24,25)(H,26,29)(H,27,30) |
| InChIKey | KVSVVWPXBNFDFJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|