C16H14BrNO3S — CID 78876840
(5-bromothiophen-3-yl)methyl 2-(5-methoxy-1H-indol-3-yl)acetate (PubChem CID 78876840) has the molecular formula C16H14BrNO3S and a molecular weight of 380.26 g/mol. Its IUPAC name is (5-bromothiophen-3-yl)methyl 2-(5-methoxy-1H-indol-3-yl)acetate.
| Compound Name | (5-bromothiophen-3-yl)methyl 2-(5-methoxy-1H-indol-3-yl)acetate |
|---|---|
| PubChem CID | 78876840 |
| Molecular Formula | C16H14BrNO3S |
| Molecular Weight | 380.26 g/mol |
| Exact Mass | 378.99 |
| IUPAC Name | (5-bromothiophen-3-yl)methyl 2-(5-methoxy-1H-indol-3-yl)acetate |
| SMILES | COc1ccc2[nH]cc(CC(=O)OCc3csc(Br)c3)c2c1 |
| InChI | InChI=1S/C16H14BrNO3S/c1-20-12-2-3-14-13(6-12)11(7-18-14)5-16(19)21-8-10-4-15(17)22-9-10/h2-4,6-7,9,18H,5,8H2,1H3 |
| InChIKey | NZOUEFVDDPFIAD-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.26 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |