C17H17FN2O3S — CID 78879191
methyl 3-[[cyclopropyl(thiophen-2-ylmethyl)carbamoyl]amino]-4-fluorobenzoate (PubChem CID 78879191) has the molecular formula C17H17FN2O3S and a molecular weight of 348.40 g/mol. Its IUPAC name is methyl 3-[[cyclopropyl(thiophen-2-ylmethyl)carbamoyl]amino]-4-fluorobenzoate.
| Compound Name | methyl 3-[[cyclopropyl(thiophen-2-ylmethyl)carbamoyl]amino]-4-fluorobenzoate |
|---|---|
| PubChem CID | 78879191 |
| Molecular Formula | C17H17FN2O3S |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | methyl 3-[[cyclopropyl(thiophen-2-ylmethyl)carbamoyl]amino]-4-fluorobenzoate |
| SMILES | COC(=O)c1ccc(F)c(NC(=O)N(Cc2cccs2)C2CC2)c1 |
| InChI | InChI=1S/C17H17FN2O3S/c1-23-16(21)11-4-7-14(18)15(9-11)19-17(22)20(12-5-6-12)10-13-3-2-8-24-13/h2-4,7-9,12H,5-6,10H2,1H3,(H,19,22) |
| InChIKey | DEYCFTYJHTZWBB-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |