C19H24N2O4S — CID 90610813
3-(2,3-dimethoxyphenyl)-1-(oxan-4-yl)-1-(thiophen-2-ylmethyl)urea (PubChem CID 90610813) has the molecular formula C19H24N2O4S and a molecular weight of 376.48 g/mol. Its IUPAC name is 3-(2,3-dimethoxyphenyl)-1-(oxan-4-yl)-1-(thiophen-2-ylmethyl)urea.
| Compound Name | 3-(2,3-dimethoxyphenyl)-1-(oxan-4-yl)-1-(thiophen-2-ylmethyl)urea |
|---|---|
| PubChem CID | 90610813 |
| Molecular Formula | C19H24N2O4S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 3-(2,3-dimethoxyphenyl)-1-(oxan-4-yl)-1-(thiophen-2-ylmethyl)urea |
| SMILES | COc1cccc(NC(=O)N(Cc2cccs2)C2CCOCC2)c1OC |
| InChI | InChI=1S/C19H24N2O4S/c1-23-17-7-3-6-16(18(17)24-2)20-19(22)21(13-15-5-4-12-26-15)14-8-10-25-11-9-14/h3-7,12,14H,8-11,13H2,1-2H3,(H,20,22) |
| InChIKey | JUPBYCCADJBPEX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |