C9H12N8O2 — CID 78881872
2-N,2-N-dimethyl-6-[(4-nitropyrazol-1-yl)methyl]-1,3,5-triazine-2,4-diamine (PubChem CID 78881872) has the molecular formula C9H12N8O2 and a molecular weight of 264.25 g/mol. Its IUPAC name is 2-N,2-N-dimethyl-6-[(4-nitropyrazol-1-yl)methyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,2-N-dimethyl-6-[(4-nitropyrazol-1-yl)methyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 78881872 |
| Molecular Formula | C9H12N8O2 |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 2-N,2-N-dimethyl-6-[(4-nitropyrazol-1-yl)methyl]-1,3,5-triazine-2,4-diamine |
| SMILES | CN(C)c1nc(N)nc(Cn2cc([N+](=O)[O-])cn2)n1 |
| InChI | InChI=1S/C9H12N8O2/c1-15(2)9-13-7(12-8(10)14-9)5-16-4-6(3-11-16)17(18)19/h3-4H,5H2,1-2H3,(H2,10,12,13,14) |
| InChIKey | QAPMDFRFOOTQRA-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 128.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|