C13H20N8O2 — CID 133421245
2-N,2-N-dimethyl-4-N-[2-(4-nitropyrazol-1-yl)ethyl]-6-propan-2-yl-1,3,5-triazine-2,4-diamine (PubChem CID 133421245) has the molecular formula C13H20N8O2 and a molecular weight of 320.36 g/mol. Its IUPAC name is 2-N,2-N-dimethyl-4-N-[2-(4-nitropyrazol-1-yl)ethyl]-6-propan-2-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,2-N-dimethyl-4-N-[2-(4-nitropyrazol-1-yl)ethyl]-6-propan-2-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 133421245 |
| Molecular Formula | C13H20N8O2 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 2-N,2-N-dimethyl-4-N-[2-(4-nitropyrazol-1-yl)ethyl]-6-propan-2-yl-1,3,5-triazine-2,4-diamine |
| SMILES | CC(C)c1nc(NCCn2cc([N+](=O)[O-])cn2)nc(N(C)C)n1 |
| InChI | InChI=1S/C13H20N8O2/c1-9(2)11-16-12(18-13(17-11)19(3)4)14-5-6-20-8-10(7-15-20)21(22)23/h7-9H,5-6H2,1-4H3,(H,14,16,17,18) |
| InChIKey | QHGMPFZIZWGQPF-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 114.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|