C21H28N2O4 — CID 78882710
1-[(4-butoxy-3-methoxyphenyl)methyl]-3-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)urea (PubChem CID 78882710) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is 1-[(4-butoxy-3-methoxyphenyl)methyl]-3-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)urea.
| Compound Name | 1-[(4-butoxy-3-methoxyphenyl)methyl]-3-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)urea |
|---|---|
| PubChem CID | 78882710 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 1-[(4-butoxy-3-methoxyphenyl)methyl]-3-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)urea |
| SMILES | CCCCOc1ccc(CNC(=O)NC2CCCc3occc32)cc1OC |
| InChI | InChI=1S/C21H28N2O4/c1-3-4-11-26-19-9-8-15(13-20(19)25-2)14-22-21(24)23-17-6-5-7-18-16(17)10-12-27-18/h8-10,12-13,17H,3-7,11,14H2,1-2H3,(H2,22,23,24) |
| InChIKey | LSPFUDGIBKLZOJ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 72.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|