C16H19BrO5S — CID 78883119
2-(5-bromo-1-benzofuran-2-yl)ethyl 2-(2-methylpropylsulfonyl)acetate (PubChem CID 78883119) has the molecular formula C16H19BrO5S and a molecular weight of 403.29 g/mol. Its IUPAC name is 2-(5-bromo-1-benzofuran-2-yl)ethyl 2-(2-methylpropylsulfonyl)acetate.
| Compound Name | 2-(5-bromo-1-benzofuran-2-yl)ethyl 2-(2-methylpropylsulfonyl)acetate |
|---|---|
| PubChem CID | 78883119 |
| Molecular Formula | C16H19BrO5S |
| Molecular Weight | 403.29 g/mol |
| Exact Mass | 402.01 |
| IUPAC Name | 2-(5-bromo-1-benzofuran-2-yl)ethyl 2-(2-methylpropylsulfonyl)acetate |
| SMILES | CC(C)CS(=O)(=O)CC(=O)OCCc1cc2cc(Br)ccc2o1 |
| InChI | InChI=1S/C16H19BrO5S/c1-11(2)9-23(19,20)10-16(18)21-6-5-14-8-12-7-13(17)3-4-15(12)22-14/h3-4,7-8,11H,5-6,9-10H2,1-2H3 |
| InChIKey | LZIVGYDBVPTAQW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.29 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |