C19H29N3O5 — CID 78883459
N-[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]-3-(4-nitrophenoxy)propanamide (PubChem CID 78883459) has the molecular formula C19H29N3O5 and a molecular weight of 379.46 g/mol. Its IUPAC name is N-[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]-3-(4-nitrophenoxy)propanamide.
| Compound Name | N-[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]-3-(4-nitrophenoxy)propanamide |
|---|---|
| PubChem CID | 78883459 |
| Molecular Formula | C19H29N3O5 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | N-[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]-3-(4-nitrophenoxy)propanamide |
| SMILES | CC1CN(C(C)(C)CNC(=O)CCOc2ccc([N+](=O)[O-])cc2)CC(C)O1 |
| InChI | InChI=1S/C19H29N3O5/c1-14-11-21(12-15(2)27-14)19(3,4)13-20-18(23)9-10-26-17-7-5-16(6-8-17)22(24)25/h5-8,14-15H,9-13H2,1-4H3,(H,20,23) |
| InChIKey | RSJDUGOFSYVJEC-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|