C23H27ClN2O4 — CID 78884620
1-(4-butoxy-3-chloro-5-ethoxybenzoyl)-3,4-dihydro-2H-quinoline-5-carboxamide (PubChem CID 78884620) has the molecular formula C23H27ClN2O4 and a molecular weight of 430.93 g/mol. Its IUPAC name is 1-(4-butoxy-3-chloro-5-ethoxybenzoyl)-3,4-dihydro-2H-quinoline-5-carboxamide.
| Compound Name | 1-(4-butoxy-3-chloro-5-ethoxybenzoyl)-3,4-dihydro-2H-quinoline-5-carboxamide |
|---|---|
| PubChem CID | 78884620 |
| Molecular Formula | C23H27ClN2O4 |
| Molecular Weight | 430.93 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 1-(4-butoxy-3-chloro-5-ethoxybenzoyl)-3,4-dihydro-2H-quinoline-5-carboxamide |
| SMILES | CCCCOc1c(Cl)cc(C(=O)N2CCCc3c(C(N)=O)cccc32)cc1OCC |
| InChI | InChI=1S/C23H27ClN2O4/c1-3-5-12-30-21-18(24)13-15(14-20(21)29-4-2)23(28)26-11-7-9-16-17(22(25)27)8-6-10-19(16)26/h6,8,10,13-14H,3-5,7,9,11-12H2,1-2H3,(H2,25,27) |
| InChIKey | MQZVMELNCNMWGL-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.93 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|