C19H23BrN2O4 — CID 78885123
N-[4-[(3-bromo-4-ethoxy-5-methoxyphenyl)methylamino]-2-methoxyphenyl]acetamide (PubChem CID 78885123) has the molecular formula C19H23BrN2O4 and a molecular weight of 423.31 g/mol. Its IUPAC name is N-[4-[(3-bromo-4-ethoxy-5-methoxyphenyl)methylamino]-2-methoxyphenyl]acetamide.
| Compound Name | N-[4-[(3-bromo-4-ethoxy-5-methoxyphenyl)methylamino]-2-methoxyphenyl]acetamide |
|---|---|
| PubChem CID | 78885123 |
| Molecular Formula | C19H23BrN2O4 |
| Molecular Weight | 423.31 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | N-[4-[(3-bromo-4-ethoxy-5-methoxyphenyl)methylamino]-2-methoxyphenyl]acetamide |
| SMILES | CCOc1c(Br)cc(CNc2ccc(NC(C)=O)c(OC)c2)cc1OC |
| InChI | InChI=1S/C19H23BrN2O4/c1-5-26-19-15(20)8-13(9-18(19)25-4)11-21-14-6-7-16(22-12(2)23)17(10-14)24-3/h6-10,21H,5,11H2,1-4H3,(H,22,23) |
| InChIKey | LBFFYFSYGYJNSP-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.31 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |