C18H14FN5O — CID 78894433
1-(2-cyano-4-fluorophenyl)-3-[(1-phenylpyrazol-4-yl)methyl]urea (PubChem CID 78894433) has the molecular formula C18H14FN5O and a molecular weight of 335.34 g/mol. Its IUPAC name is 1-(2-cyano-4-fluorophenyl)-3-[(1-phenylpyrazol-4-yl)methyl]urea.
| Compound Name | 1-(2-cyano-4-fluorophenyl)-3-[(1-phenylpyrazol-4-yl)methyl]urea |
|---|---|
| PubChem CID | 78894433 |
| Molecular Formula | C18H14FN5O |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 1-(2-cyano-4-fluorophenyl)-3-[(1-phenylpyrazol-4-yl)methyl]urea |
| SMILES | N#Cc1cc(F)ccc1NC(=O)NCc1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C18H14FN5O/c19-15-6-7-17(14(8-15)9-20)23-18(25)21-10-13-11-22-24(12-13)16-4-2-1-3-5-16/h1-8,11-12H,10H2,(H2,21,23,25) |
| InChIKey | CZWDJAPDYCGGSO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 82.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |