C17H23FN4O3 — CID 78896128
ethyl N-[1-[(2-cyano-4-fluorophenyl)carbamoylamino]-4-methylpentan-2-yl]carbamate (PubChem CID 78896128) has the molecular formula C17H23FN4O3 and a molecular weight of 350.39 g/mol. Its IUPAC name is ethyl N-[1-[(2-cyano-4-fluorophenyl)carbamoylamino]-4-methylpentan-2-yl]carbamate.
| Compound Name | ethyl N-[1-[(2-cyano-4-fluorophenyl)carbamoylamino]-4-methylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 78896128 |
| Molecular Formula | C17H23FN4O3 |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | ethyl N-[1-[(2-cyano-4-fluorophenyl)carbamoylamino]-4-methylpentan-2-yl]carbamate |
| SMILES | CCOC(=O)NC(CNC(=O)Nc1ccc(F)cc1C#N)CC(C)C |
| InChI | InChI=1S/C17H23FN4O3/c1-4-25-17(24)21-14(7-11(2)3)10-20-16(23)22-15-6-5-13(18)8-12(15)9-19/h5-6,8,11,14H,4,7,10H2,1-3H3,(H,21,24)(H2,20,22,23) |
| InChIKey | CFDURMOSRDJPKX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 103.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |