C14H14N4OS — CID 78900626
N-(1-cyanocyclopentyl)-5-thiophen-2-yl-1H-pyrazole-3-carboxamide (PubChem CID 78900626) has the molecular formula C14H14N4OS and a molecular weight of 286.36 g/mol. Its IUPAC name is N-(1-cyanocyclopentyl)-5-thiophen-2-yl-1H-pyrazole-3-carboxamide.
| Compound Name | N-(1-cyanocyclopentyl)-5-thiophen-2-yl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 78900626 |
| Molecular Formula | C14H14N4OS |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | N-(1-cyanocyclopentyl)-5-thiophen-2-yl-1H-pyrazole-3-carboxamide |
| SMILES | N#CC1(NC(=O)c2cc(-c3cccs3)[nH]n2)CCCC1 |
| InChI | InChI=1S/C14H14N4OS/c15-9-14(5-1-2-6-14)16-13(19)11-8-10(17-18-11)12-4-3-7-20-12/h3-4,7-8H,1-2,5-6H2,(H,16,19)(H,17,18) |
| InChIKey | AMHLNAFCWXWQNN-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 81.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |