C18H20N2O3S2 — CID 78905967
N-ethyl-N-[4-[3-(3-methoxy-4-methylsulfanylphenyl)-3-oxoprop-1-enyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 78905967) has the molecular formula C18H20N2O3S2 and a molecular weight of 376.50 g/mol. Its IUPAC name is N-ethyl-N-[4-[3-(3-methoxy-4-methylsulfanylphenyl)-3-oxoprop-1-enyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-ethyl-N-[4-[3-(3-methoxy-4-methylsulfanylphenyl)-3-oxoprop-1-enyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 78905967 |
| Molecular Formula | C18H20N2O3S2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | N-ethyl-N-[4-[3-(3-methoxy-4-methylsulfanylphenyl)-3-oxoprop-1-enyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CCN(C(C)=O)c1nc(C=CC(=O)c2ccc(SC)c(OC)c2)cs1 |
| InChI | InChI=1S/C18H20N2O3S2/c1-5-20(12(2)21)18-19-14(11-25-18)7-8-15(22)13-6-9-17(24-4)16(10-13)23-3/h6-11H,5H2,1-4H3 |
| InChIKey | FZAOMLLXPINYFI-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|