C19H22N2O4S — CID 47046298
N-ethyl-N-[4-[(E)-3-[4-(2-methoxyethoxy)phenyl]-3-oxoprop-1-enyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 47046298) has the molecular formula C19H22N2O4S and a molecular weight of 374.46 g/mol. Its IUPAC name is N-ethyl-N-[4-[(E)-3-[4-(2-methoxyethoxy)phenyl]-3-oxoprop-1-enyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-ethyl-N-[4-[(E)-3-[4-(2-methoxyethoxy)phenyl]-3-oxoprop-1-enyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 47046298 |
| Molecular Formula | C19H22N2O4S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | N-ethyl-N-[4-[(E)-3-[4-(2-methoxyethoxy)phenyl]-3-oxoprop-1-enyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CCN(C(C)=O)c1nc(/C=C/C(=O)c2ccc(OCCOC)cc2)cs1 |
| InChI | InChI=1S/C19H22N2O4S/c1-4-21(14(2)22)19-20-16(13-26-19)7-10-18(23)15-5-8-17(9-6-15)25-12-11-24-3/h5-10,13H,4,11-12H2,1-3H3/b10-7+ |
| InChIKey | BMBYEISZYOEQQK-JXMROGBWSA-N |
| XLogP | 3.44 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|