C12H14N4OS — CID 78909366
4-(2-ethoxyphenyl)-6-methylsulfanyl-1,3,5-triazin-2-amine (PubChem CID 78909366) has the molecular formula C12H14N4OS and a molecular weight of 262.34 g/mol. Its IUPAC name is 4-(2-ethoxyphenyl)-6-methylsulfanyl-1,3,5-triazin-2-amine.
| Compound Name | 4-(2-ethoxyphenyl)-6-methylsulfanyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 78909366 |
| Molecular Formula | C12H14N4OS |
| Molecular Weight | 262.34 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 4-(2-ethoxyphenyl)-6-methylsulfanyl-1,3,5-triazin-2-amine |
| SMILES | CCOc1ccccc1-c1nc(N)nc(SC)n1 |
| InChI | InChI=1S/C12H14N4OS/c1-3-17-9-7-5-4-6-8(9)10-14-11(13)16-12(15-10)18-2/h4-7H,3H2,1-2H3,(H2,13,14,15,16) |
| InChIKey | XIDMOFSFHSCLGZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.34 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |