C12H16N4O5 — CID 78919600
methyl (3S)-1-[2-(3-nitropyrazol-1-yl)acetyl]piperidine-3-carboxylate (PubChem CID 78919600) has the molecular formula C12H16N4O5 and a molecular weight of 296.28 g/mol. Its IUPAC name is methyl (3S)-1-[2-(3-nitropyrazol-1-yl)acetyl]piperidine-3-carboxylate.
| Compound Name | methyl (3S)-1-[2-(3-nitropyrazol-1-yl)acetyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 78919600 |
| Molecular Formula | C12H16N4O5 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | methyl (3S)-1-[2-(3-nitropyrazol-1-yl)acetyl]piperidine-3-carboxylate |
| SMILES | COC(=O)[C@H]1CCCN(C(=O)Cn2ccc([N+](=O)[O-])n2)C1 |
| InChI | InChI=1S/C12H16N4O5/c1-21-12(18)9-3-2-5-14(7-9)11(17)8-15-6-4-10(13-15)16(19)20/h4,6,9H,2-3,5,7-8H2,1H3/t9-/m0/s1 |
| InChIKey | ICLSYOIMDHDQBN-VIFPVBQESA-N |
| XLogP | 0.20 |
| TPSA | 107.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|