C9H11BrN2S — CID 78924538
3-[(3-bromothiophen-2-yl)methylamino]butanenitrile (PubChem CID 78924538) has the molecular formula C9H11BrN2S and a molecular weight of 259.17 g/mol. Its IUPAC name is 3-[(3-bromothiophen-2-yl)methylamino]butanenitrile.
| Compound Name | 3-[(3-bromothiophen-2-yl)methylamino]butanenitrile |
|---|---|
| PubChem CID | 78924538 |
| Molecular Formula | C9H11BrN2S |
| Molecular Weight | 259.17 g/mol |
| Exact Mass | 257.98 |
| IUPAC Name | 3-[(3-bromothiophen-2-yl)methylamino]butanenitrile |
| SMILES | CC(CC#N)NCc1sccc1Br |
| InChI | InChI=1S/C9H11BrN2S/c1-7(2-4-11)12-6-9-8(10)3-5-13-9/h3,5,7,12H,2,6H2,1H3 |
| InChIKey | AVKAZAILOHFQOM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.17 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |