C10H14N2S — CID 78953450
3-[(3-methylthiophen-2-yl)methylamino]butanenitrile (PubChem CID 78953450) has the molecular formula C10H14N2S and a molecular weight of 194.30 g/mol. Its IUPAC name is 3-[(3-methylthiophen-2-yl)methylamino]butanenitrile.
| Compound Name | 3-[(3-methylthiophen-2-yl)methylamino]butanenitrile |
|---|---|
| PubChem CID | 78953450 |
| Molecular Formula | C10H14N2S |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 3-[(3-methylthiophen-2-yl)methylamino]butanenitrile |
| SMILES | Cc1ccsc1CNC(C)CC#N |
| InChI | InChI=1S/C10H14N2S/c1-8-4-6-13-10(8)7-12-9(2)3-5-11/h4,6,9,12H,3,7H2,1-2H3 |
| InChIKey | GBCTUQDXLOUBLP-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |