C27H28BrNO7 — CID 7894792
methyl (4S,7S)-4-(3-bromo-4-hydroxy-5-methoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate (PubChem CID 7894792) has the molecular formula C27H28BrNO7 and a molecular weight of 558.43 g/mol. Its IUPAC name is methyl (4S,7S)-4-(3-bromo-4-hydroxy-5-methoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate.
| Compound Name | methyl (4S,7S)-4-(3-bromo-4-hydroxy-5-methoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 7894792 |
| Molecular Formula | C27H28BrNO7 |
| Molecular Weight | 558.43 g/mol |
| Exact Mass | 557.10 |
| IUPAC Name | methyl (4S,7S)-4-(3-bromo-4-hydroxy-5-methoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
| SMILES | COC(=O)C1C(C)=NC2=C(C(=O)C[C@@H](c3ccc(OC)c(OC)c3)C2)[C@@H]1c1cc(Br)c(O)c(OC)c1 |
| InChI | InChI=1S/C27H28BrNO7/c1-13-23(27(32)36-5)24(16-8-17(28)26(31)22(12-16)35-4)25-18(29-13)9-15(10-19(25)30)14-6-7-20(33-2)21(11-14)34-3/h6-8,11-12,15,23-24,31H,9-10H2,1-5H3/t15-,23?,24+/m0/s1 |
| InChIKey | KUZWBNJMCHTCLC-RMHAFUEUSA-N |
| XLogP | 4.93 |
| TPSA | 103.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.43 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |