C30H34BrNO8 — CID 7894903
2-methoxyethyl (4S,7R)-4-(3-bromo-4,5-dimethoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate (PubChem CID 7894903) has the molecular formula C30H34BrNO8 and a molecular weight of 616.51 g/mol. Its IUPAC name is 2-methoxyethyl (4S,7R)-4-(3-bromo-4,5-dimethoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate.
| Compound Name | 2-methoxyethyl (4S,7R)-4-(3-bromo-4,5-dimethoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 7894903 |
| Molecular Formula | C30H34BrNO8 |
| Molecular Weight | 616.51 g/mol |
| Exact Mass | 615.15 |
| IUPAC Name | 2-methoxyethyl (4S,7R)-4-(3-bromo-4,5-dimethoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
| SMILES | COCCOC(=O)C1C(C)=NC2=C(C(=O)C[C@H](c3ccc(OC)c(OC)c3)C2)[C@@H]1c1cc(Br)c(OC)c(OC)c1 |
| InChI | InChI=1S/C30H34BrNO8/c1-16-26(30(34)40-10-9-35-2)27(19-11-20(31)29(39-6)25(15-19)38-5)28-21(32-16)12-18(13-22(28)33)17-7-8-23(36-3)24(14-17)37-4/h7-8,11,14-15,18,26-27H,9-10,12-13H2,1-6H3/t18-,26?,27-/m1/s1 |
| InChIKey | ATHZWBXRZWCEBM-KYQBQFKGSA-N |
| XLogP | 5.25 |
| TPSA | 101.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.51 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|