C14H17F2N3 — CID 78955340
4-[(1-ethylpiperidin-3-yl)amino]-3,5-difluorobenzonitrile (PubChem CID 78955340) has the molecular formula C14H17F2N3 and a molecular weight of 265.31 g/mol. Its IUPAC name is 4-[(1-ethylpiperidin-3-yl)amino]-3,5-difluorobenzonitrile.
| Compound Name | 4-[(1-ethylpiperidin-3-yl)amino]-3,5-difluorobenzonitrile |
|---|---|
| PubChem CID | 78955340 |
| Molecular Formula | C14H17F2N3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 4-[(1-ethylpiperidin-3-yl)amino]-3,5-difluorobenzonitrile |
| SMILES | CCN1CCCC(Nc2c(F)cc(C#N)cc2F)C1 |
| InChI | InChI=1S/C14H17F2N3/c1-2-19-5-3-4-11(9-19)18-14-12(15)6-10(8-17)7-13(14)16/h6-7,11,18H,2-5,9H2,1H3 |
| InChIKey | BMEGGOJYMFHBRS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |