C13H15F2N3 — CID 106996303
3,5-difluoro-4-[(2-methylpiperidin-4-yl)amino]benzonitrile (PubChem CID 106996303) has the molecular formula C13H15F2N3 and a molecular weight of 251.28 g/mol. Its IUPAC name is 3,5-difluoro-4-[(2-methylpiperidin-4-yl)amino]benzonitrile.
| Compound Name | 3,5-difluoro-4-[(2-methylpiperidin-4-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 106996303 |
| Molecular Formula | C13H15F2N3 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 3,5-difluoro-4-[(2-methylpiperidin-4-yl)amino]benzonitrile |
| SMILES | CC1CC(Nc2c(F)cc(C#N)cc2F)CCN1 |
| InChI | InChI=1S/C13H15F2N3/c1-8-4-10(2-3-17-8)18-13-11(14)5-9(7-16)6-12(13)15/h5-6,8,10,17-18H,2-4H2,1H3 |
| InChIKey | UXNSHGYSAPVPCC-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 47.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |