C24H24ClN2O6+ — CID 7897189
(5R)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-5-(3-chlorophenyl)-1-(2-morpholin-4-ium-4-ylethyl)pyrrolidine-2,3-dione (PubChem CID 7897189) has the molecular formula C24H24ClN2O6+ and a molecular weight of 471.92 g/mol. Its IUPAC name is (5R)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-5-(3-chlorophenyl)-1-(2-morpholin-4-ium-4-ylethyl)pyrrolidine-2,3-dione.
| Compound Name | (5R)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-5-(3-chlorophenyl)-1-(2-morpholin-4-ium-4-ylethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 7897189 |
| Molecular Formula | C24H24ClN2O6+ |
| Molecular Weight | 471.92 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | (5R)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-5-(3-chlorophenyl)-1-(2-morpholin-4-ium-4-ylethyl)pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(CC[NH+]2CCOCC2)[C@H](c2cccc(Cl)c2)C1=C(O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H23ClN2O6/c25-17-3-1-2-15(12-17)21-20(22(28)16-4-5-18-19(13-16)33-14-32-18)23(29)24(30)27(21)7-6-26-8-10-31-11-9-26/h1-5,12-13,21,28H,6-11,14H2/p+1/t21-/m1/s1 |
| InChIKey | MGCGVTJTRLAXKT-OAQYLSRUSA-O |
| XLogP | 1.41 |
| TPSA | 89.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.92 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|