C14H12F2N2O2 — CID 78985193
3-amino-N-(2,5-difluorophenyl)-5-methoxybenzamide (PubChem CID 78985193) has the molecular formula C14H12F2N2O2 and a molecular weight of 278.26 g/mol. Its IUPAC name is 3-amino-N-(2,5-difluorophenyl)-5-methoxybenzamide.
| Compound Name | 3-amino-N-(2,5-difluorophenyl)-5-methoxybenzamide |
|---|---|
| PubChem CID | 78985193 |
| Molecular Formula | C14H12F2N2O2 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 3-amino-N-(2,5-difluorophenyl)-5-methoxybenzamide |
| SMILES | COc1cc(N)cc(C(=O)Nc2cc(F)ccc2F)c1 |
| InChI | InChI=1S/C14H12F2N2O2/c1-20-11-5-8(4-10(17)7-11)14(19)18-13-6-9(15)2-3-12(13)16/h2-7H,17H2,1H3,(H,18,19) |
| InChIKey | HLEMCTYBLZEGGW-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|