C13H11N5O2S — CID 78987214
methyl 1-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)-1,2,4-triazole-3-carboxylate (PubChem CID 78987214) has the molecular formula C13H11N5O2S and a molecular weight of 301.33 g/mol. Its IUPAC name is methyl 1-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)-1,2,4-triazole-3-carboxylate.
| Compound Name | methyl 1-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)-1,2,4-triazole-3-carboxylate |
|---|---|
| PubChem CID | 78987214 |
| Molecular Formula | C13H11N5O2S |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | methyl 1-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)-1,2,4-triazole-3-carboxylate |
| SMILES | COC(=O)c1ncn(-c2ncnc3sc4c(c23)CCC4)n1 |
| InChI | InChI=1S/C13H11N5O2S/c1-20-13(19)10-16-6-18(17-10)11-9-7-3-2-4-8(7)21-12(9)15-5-14-11/h5-6H,2-4H2,1H3 |
| InChIKey | XKWNQZLTYDOTSD-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 82.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |