C12H8N6S — CID 26019315
1-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)-1,2,4-triazole-3-carbonitrile (PubChem CID 26019315) has the molecular formula C12H8N6S and a molecular weight of 268.31 g/mol. Its IUPAC name is 1-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)-1,2,4-triazole-3-carbonitrile.
| Compound Name | 1-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)-1,2,4-triazole-3-carbonitrile |
|---|---|
| PubChem CID | 26019315 |
| Molecular Formula | C12H8N6S |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 1-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)-1,2,4-triazole-3-carbonitrile |
| SMILES | N#Cc1ncn(-c2ncnc3sc4c(c23)CCC4)n1 |
| InChI | InChI=1S/C12H8N6S/c13-4-9-16-6-18(17-9)11-10-7-2-1-3-8(7)19-12(10)15-5-14-11/h5-6H,1-3H2 |
| InChIKey | NDNVEUYIPFQNSV-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 80.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |