C16H19N3 — CID 78995583
3-phenyl-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]prop-2-yn-1-amine (PubChem CID 78995583) has the molecular formula C16H19N3 and a molecular weight of 253.35 g/mol. Its IUPAC name is 3-phenyl-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]prop-2-yn-1-amine.
| Compound Name | 3-phenyl-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 78995583 |
| Molecular Formula | C16H19N3 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 3-phenyl-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]prop-2-yn-1-amine |
| SMILES | Cc1nn(C)c(C)c1CNCC#Cc1ccccc1 |
| InChI | InChI=1S/C16H19N3/c1-13-16(14(2)19(3)18-13)12-17-11-7-10-15-8-5-4-6-9-15/h4-6,8-9,17H,11-12H2,1-3H3 |
| InChIKey | UTUBXLCHUVJHAC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|