C14H15N3O3S — CID 78996449
7-(2-phenylsulfanylacetyl)-1,3,7-triazaspiro[4.4]nonane-2,4-dione (PubChem CID 78996449) has the molecular formula C14H15N3O3S and a molecular weight of 305.36 g/mol. Its IUPAC name is 7-(2-phenylsulfanylacetyl)-1,3,7-triazaspiro[4.4]nonane-2,4-dione.
| Compound Name | 7-(2-phenylsulfanylacetyl)-1,3,7-triazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 78996449 |
| Molecular Formula | C14H15N3O3S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 7-(2-phenylsulfanylacetyl)-1,3,7-triazaspiro[4.4]nonane-2,4-dione |
| SMILES | O=C1NC(=O)C2(CCN(C(=O)CSc3ccccc3)C2)N1 |
| InChI | InChI=1S/C14H15N3O3S/c18-11(8-21-10-4-2-1-3-5-10)17-7-6-14(9-17)12(19)15-13(20)16-14/h1-5H,6-9H2,(H2,15,16,19,20) |
| InChIKey | WQHHACNWKONXAH-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|