C13H15BrN2O3 — CID 79026757
4-[2-bromo-4-[(1R)-1-hydroxyethyl]phenyl]-3-methylpiperazine-2,6-dione (PubChem CID 79026757) has the molecular formula C13H15BrN2O3 and a molecular weight of 327.18 g/mol. Its IUPAC name is 4-[2-bromo-4-[(1R)-1-hydroxyethyl]phenyl]-3-methylpiperazine-2,6-dione.
| Compound Name | 4-[2-bromo-4-[(1R)-1-hydroxyethyl]phenyl]-3-methylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 79026757 |
| Molecular Formula | C13H15BrN2O3 |
| Molecular Weight | 327.18 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | 4-[2-bromo-4-[(1R)-1-hydroxyethyl]phenyl]-3-methylpiperazine-2,6-dione |
| SMILES | CC1C(=O)NC(=O)CN1c1ccc([C@@H](C)O)cc1Br |
| InChI | InChI=1S/C13H15BrN2O3/c1-7-13(19)15-12(18)6-16(7)11-4-3-9(8(2)17)5-10(11)14/h3-5,7-8,17H,6H2,1-2H3,(H,15,18,19)/t7?,8-/m1/s1 |
| InChIKey | CCUYFOODUCUJQT-BRFYHDHCSA-N |
| XLogP | 1.35 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.18 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|