C14H18BrN3O2 — CID 82968031
4-[5-bromo-2-[1-(methylamino)ethyl]phenyl]-3-methylpiperazine-2,6-dione (PubChem CID 82968031) has the molecular formula C14H18BrN3O2 and a molecular weight of 340.22 g/mol. Its IUPAC name is 4-[5-bromo-2-[1-(methylamino)ethyl]phenyl]-3-methylpiperazine-2,6-dione.
| Compound Name | 4-[5-bromo-2-[1-(methylamino)ethyl]phenyl]-3-methylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 82968031 |
| Molecular Formula | C14H18BrN3O2 |
| Molecular Weight | 340.22 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 4-[5-bromo-2-[1-(methylamino)ethyl]phenyl]-3-methylpiperazine-2,6-dione |
| SMILES | CNC(C)c1ccc(Br)cc1N1CC(=O)NC(=O)C1C |
| InChI | InChI=1S/C14H18BrN3O2/c1-8(16-3)11-5-4-10(15)6-12(11)18-7-13(19)17-14(20)9(18)2/h4-6,8-9,16H,7H2,1-3H3,(H,17,19,20) |
| InChIKey | CXNIBMUHAXJBMU-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.22 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|