About 6-(3,3-dimethylpyrrolidin-1-yl)pyrazin-2-amine
6-(3,3-dimethylpyrrolidin-1-yl)pyrazin-2-amine (PubChem CID 79034078) has the molecular formula C10H16N4
and a molecular weight of 192.27 g/mol. Its IUPAC name is 6-(3,3-dimethylpyrrolidin-1-yl)pyrazin-2-amine.
Molecular Properties
| Compound Name | 6-(3,3-dimethylpyrrolidin-1-yl)pyrazin-2-amine |
| PubChem CID | 79034078 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 6-(3,3-dimethylpyrrolidin-1-yl)pyrazin-2-amine |
| SMILES | CC1(C)CCN(c2cncc(N)n2)C1 |
| InChI | InChI=1S/C10H16N4/c1-10(2)3-4-14(7-10)9-6-12-5-8(11)13-9/h5-6H,3-4,7H2,1-2H3,(H2,11,13) |
| InChIKey | LSGOJPMWNFPTDS-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(3,3-dimethylpyrrolidin-1-yl)pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3,3-dimethylpyrrolidin-1-yl)pyrazin-2-amine?
The IUPAC name of 6-(3,3-dimethylpyrrolidin-1-yl)pyrazin-2-amine (CID 79034078) is 6-(3,3-dimethylpyrrolidin-1-yl)pyrazin-2-amine.
What is the SMILES notation for 6-(3,3-dimethylpyrrolidin-1-yl)pyrazin-2-amine?
The canonical SMILES for 6-(3,3-dimethylpyrrolidin-1-yl)pyrazin-2-amine is CC1(C)CCN(c2cncc(N)n2)C1.
What is the InChIKey of 6-(3,3-dimethylpyrrolidin-1-yl)pyrazin-2-amine?
The InChIKey is LSGOJPMWNFPTDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4/c1-10(2)3-4-14(7-10)9-6-12-5-8(11)13-9/h5-6H,3-4,7H2,1-2H3,(H2,11,13).
What are the key properties of 6-(3,3-dimethylpyrrolidin-1-yl)pyrazin-2-amine?
6-(3,3-dimethylpyrrolidin-1-yl)pyrazin-2-amine has a molecular weight of 192.27 g/mol, XLogP of 1.30, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,3-dimethylpyrrolidin-1-yl)pyrazin-2-amine is sourced from PubChem (CID 79034078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).