C12H17N3O4S — CID 79042560
1-[(2-methyl-3-pyridinyl)sulfamoyl]piperidine-2-carboxylic acid (PubChem CID 79042560) has the molecular formula C12H17N3O4S and a molecular weight of 299.35 g/mol. Its IUPAC name is 1-[(2-methyl-3-pyridinyl)sulfamoyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[(2-methyl-3-pyridinyl)sulfamoyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 79042560 |
| Molecular Formula | C12H17N3O4S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 1-[(2-methyl-3-pyridinyl)sulfamoyl]piperidine-2-carboxylic acid |
| SMILES | Cc1ncccc1NS(=O)(=O)N1CCCCC1C(=O)O |
| InChI | InChI=1S/C12H17N3O4S/c1-9-10(5-4-7-13-9)14-20(18,19)15-8-3-2-6-11(15)12(16)17/h4-5,7,11,14H,2-3,6,8H2,1H3,(H,16,17) |
| InChIKey | UAXGSSORRLYSAQ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |