C16H14FNO2S — CID 79046237
N-(3-fluoro-5-methylphenyl)-5-(4-hydroxybut-1-ynyl)thiophene-2-carboxamide (PubChem CID 79046237) has the molecular formula C16H14FNO2S and a molecular weight of 303.36 g/mol. Its IUPAC name is N-(3-fluoro-5-methylphenyl)-5-(4-hydroxybut-1-ynyl)thiophene-2-carboxamide.
| Compound Name | N-(3-fluoro-5-methylphenyl)-5-(4-hydroxybut-1-ynyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 79046237 |
| Molecular Formula | C16H14FNO2S |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | N-(3-fluoro-5-methylphenyl)-5-(4-hydroxybut-1-ynyl)thiophene-2-carboxamide |
| SMILES | Cc1cc(F)cc(NC(=O)c2ccc(C#CCCO)s2)c1 |
| InChI | InChI=1S/C16H14FNO2S/c1-11-8-12(17)10-13(9-11)18-16(20)15-6-5-14(21-15)4-2-3-7-19/h5-6,8-10,19H,3,7H2,1H3,(H,18,20) |
| InChIKey | IOARLKGJYPJVQD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|