C19H32N2 — CID 79046794
3-N,3-N-diethyl-3-methyl-1-(1,2,3,4-tetrahydronaphthalen-1-yl)butane-2,3-diamine (PubChem CID 79046794) has the molecular formula C19H32N2 and a molecular weight of 288.48 g/mol. Its IUPAC name is 3-N,3-N-diethyl-3-methyl-1-(1,2,3,4-tetrahydronaphthalen-1-yl)butane-2,3-diamine.
| Compound Name | 3-N,3-N-diethyl-3-methyl-1-(1,2,3,4-tetrahydronaphthalen-1-yl)butane-2,3-diamine |
|---|---|
| PubChem CID | 79046794 |
| Molecular Formula | C19H32N2 |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.26 |
| IUPAC Name | 3-N,3-N-diethyl-3-methyl-1-(1,2,3,4-tetrahydronaphthalen-1-yl)butane-2,3-diamine |
| SMILES | CCN(CC)C(C)(C)C(N)CC1CCCc2ccccc21 |
| InChI | InChI=1S/C19H32N2/c1-5-21(6-2)19(3,4)18(20)14-16-12-9-11-15-10-7-8-13-17(15)16/h7-8,10,13,16,18H,5-6,9,11-12,14,20H2,1-4H3 |
| InChIKey | KDMHIHHFKIKYSI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |